C23H39ClN2O — CID 58457574
(3S)-4-[4-(4-chlorocyclohexa-1,5-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-(cyclopentylmethylamino)butan-2-ol (PubChem CID 58457574) has the molecular formula C23H39ClN2O and a molecular weight of 395.03 g/mol. Its IUPAC name is (3S)-4-[4-(4-chlorocyclohexa-1,5-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-(cyclopentylmethylamino)butan-2-ol.
| Compound Name | (3S)-4-[4-(4-chlorocyclohexa-1,5-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-(cyclopentylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 58457574 |
| Molecular Formula | C23H39ClN2O |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 394.28 |
| IUPAC Name | (3S)-4-[4-(4-chlorocyclohexa-1,5-dien-1-yl)-3,3-dimethylpiperidin-1-yl]-3-(cyclopentylmethylamino)butan-2-ol |
| SMILES | CC(O)[C@H](CN1CCC(C2=CCC(Cl)C=C2)C(C)(C)C1)NCC1CCCC1 |
| InChI | InChI=1S/C23H39ClN2O/c1-17(27)22(25-14-18-6-4-5-7-18)15-26-13-12-21(23(2,3)16-26)19-8-10-20(24)11-9-19/h8-10,17-18,20-22,25,27H,4-7,11-16H2,1-3H3/t17?,20?,21?,22-/m0/s1 |
| InChIKey | MYJWLQIBOHUXMS-MUBNQFKJSA-N |
| XLogP | 4.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|