C24H39ClN3O- — CID 58457597
1-N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-N-oxidocyclohexa-1,3-diene-1,3-diamine (PubChem CID 58457597) has the molecular formula C24H39ClN3O- and a molecular weight of 421.05 g/mol. Its IUPAC name is 1-N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-N-oxidocyclohexa-1,3-diene-1,3-diamine.
| Compound Name | 1-N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-N-oxidocyclohexa-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 58457597 |
| Molecular Formula | C24H39ClN3O- |
| Molecular Weight | 421.05 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-N-oxidocyclohexa-1,3-diene-1,3-diamine |
| SMILES | CC(C)[C@H](CN1CC[C@H](C2C=CC(Cl)CC2)C(C)(C)C1)NC1=CC(N[O-])=CCC1 |
| InChI | InChI=1S/C24H39ClN3O/c1-17(2)23(26-20-6-5-7-21(14-20)27-29)15-28-13-12-22(24(3,4)16-28)18-8-10-19(25)11-9-18/h7-8,10,14,17-19,22-23,26-27H,5-6,9,11-13,15-16H2,1-4H3/q-1/t18?,19?,22-,23+/m1/s1 |
| InChIKey | WDCOITORJAQKNB-QCTQWFPSSA-N |
| XLogP | 5.17 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.05 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|