C27H47ClF3N3S — CID 58457599
(2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[[3-[(trifluoromethylsulfanylamino)methyl]cyclohexyl]methyl]butan-2-amine (PubChem CID 58457599) has the molecular formula C27H47ClF3N3S and a molecular weight of 538.21 g/mol. Its IUPAC name is (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[[3-[(trifluoromethylsulfanylamino)methyl]cyclohexyl]methyl]butan-2-amine.
| Compound Name | (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[[3-[(trifluoromethylsulfanylamino)methyl]cyclohexyl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 58457599 |
| Molecular Formula | C27H47ClF3N3S |
| Molecular Weight | 538.21 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | (2R)-1-[(4R)-4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[[3-[(trifluoromethylsulfanylamino)methyl]cyclohexyl]methyl]butan-2-amine |
| SMILES | CC(C)[C@H](CN1CC[C@H](C2=CCC(Cl)CC2)C(C)(C)C1)NCC1CCCC(CNSC(F)(F)F)C1 |
| InChI | InChI=1S/C27H47ClF3N3S/c1-19(2)25(32-15-20-6-5-7-21(14-20)16-33-35-27(29,30)31)17-34-13-12-24(26(3,4)18-34)22-8-10-23(28)11-9-22/h8,19-21,23-25,32-33H,5-7,9-18H2,1-4H3/t20?,21?,23?,24-,25+/m1/s1 |
| InChIKey | ZQPIZDSPBDERIK-LVRZERHZSA-N |
| XLogP | 7.23 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.21 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|