C24H37Cl2FN2 — CID 58457677
(2R)-1-[4-(3,4-dichlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-N-[2-(4-fluorocyclohex-2-en-1-yl)ethyl]-3-methylbutan-2-amine (PubChem CID 58457677) has the molecular formula C24H37Cl2FN2 and a molecular weight of 443.48 g/mol. Its IUPAC name is (2R)-1-[4-(3,4-dichlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-N-[2-(4-fluorocyclohex-2-en-1-yl)ethyl]-3-methylbutan-2-amine.
| Compound Name | (2R)-1-[4-(3,4-dichlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-N-[2-(4-fluorocyclohex-2-en-1-yl)ethyl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457677 |
| Molecular Formula | C24H37Cl2FN2 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (2R)-1-[4-(3,4-dichlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-N-[2-(4-fluorocyclohex-2-en-1-yl)ethyl]-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2=CC(Cl)C(Cl)C=C2)CC1)NCCC1C=CC(F)CC1 |
| InChI | InChI=1S/C24H37Cl2FN2/c1-17(2)24(28-12-9-18-3-6-21(27)7-4-18)16-29-13-10-19(11-14-29)20-5-8-22(25)23(26)15-20/h3,5-6,8,15,17-19,21-24,28H,4,7,9-14,16H2,1-2H3/t18?,21?,22?,23?,24-/m0/s1 |
| InChIKey | UBBNVNJRJZLJMS-VGFVAMRHSA-N |
| XLogP | 5.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|