C28H50ClN3O2 — CID 58457733
1-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[3-(methoxymethyl)cyclohexyl]methyl]urea (PubChem CID 58457733) has the molecular formula C28H50ClN3O2 and a molecular weight of 496.18 g/mol. Its IUPAC name is 1-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[3-(methoxymethyl)cyclohexyl]methyl]urea.
| Compound Name | 1-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[3-(methoxymethyl)cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 58457733 |
| Molecular Formula | C28H50ClN3O2 |
| Molecular Weight | 496.18 g/mol |
| Exact Mass | 495.36 |
| IUPAC Name | 1-[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-[[3-(methoxymethyl)cyclohexyl]methyl]urea |
| SMILES | COCC1CCCC(CNC(=O)N[C@@H](CN2CCC(C3=CCC(Cl)CC3)C(C)(C)C2)C(C)C)C1 |
| InChI | InChI=1S/C28H50ClN3O2/c1-20(2)26(31-27(33)30-16-21-7-6-8-22(15-21)18-34-5)17-32-14-13-25(28(3,4)19-32)23-9-11-24(29)12-10-23/h9,20-22,24-26H,6-8,10-19H2,1-5H3,(H2,30,31,33)/t21?,22?,24?,25?,26-/m0/s1 |
| InChIKey | NJNUQPVZLCLENH-ZGUKRASKSA-N |
| XLogP | 5.83 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.18 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|