C25H37ClN4S — CID 58457898
(2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methyl-N-[[2-(1,2,3,6-tetrahydropyridin-3-yl)-1,3-thiazol-4-yl]methyl]butan-2-amine (PubChem CID 58457898) has the molecular formula C25H37ClN4S and a molecular weight of 461.12 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methyl-N-[[2-(1,2,3,6-tetrahydropyridin-3-yl)-1,3-thiazol-4-yl]methyl]butan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methyl-N-[[2-(1,2,3,6-tetrahydropyridin-3-yl)-1,3-thiazol-4-yl]methyl]butan-2-amine |
|---|---|
| PubChem CID | 58457898 |
| Molecular Formula | C25H37ClN4S |
| Molecular Weight | 461.12 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohexa-1,5-dien-1-yl)piperidin-1-yl]-3-methyl-N-[[2-(1,2,3,6-tetrahydropyridin-3-yl)-1,3-thiazol-4-yl]methyl]butan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)C=C2)CC1)NCc1csc(C2C=CCNC2)n1 |
| InChI | InChI=1S/C25H37ClN4S/c1-18(2)24(28-15-23-17-31-25(29-23)21-4-3-11-27-14-21)16-30-12-9-20(10-13-30)19-5-7-22(26)8-6-19/h3-7,17-18,20-22,24,27-28H,8-16H2,1-2H3/t21?,22?,24-/m0/s1 |
| InChIKey | HUJZNMZUAVTAAP-IWAAJCSBSA-N |
| XLogP | 4.71 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.12 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|