C26H43ClN2O2 — CID 58457920
(4S)-4-(4-chlorocyclohexen-1-yl)-1-[(2R)-2-[(4-methoxycyclohexa-2,4-dien-1-yl)methylamino]-3-methylbutyl]-3,3-dimethylpiperidin-4-ol (PubChem CID 58457920) has the molecular formula C26H43ClN2O2 and a molecular weight of 451.10 g/mol. Its IUPAC name is (4S)-4-(4-chlorocyclohexen-1-yl)-1-[(2R)-2-[(4-methoxycyclohexa-2,4-dien-1-yl)methylamino]-3-methylbutyl]-3,3-dimethylpiperidin-4-ol.
| Compound Name | (4S)-4-(4-chlorocyclohexen-1-yl)-1-[(2R)-2-[(4-methoxycyclohexa-2,4-dien-1-yl)methylamino]-3-methylbutyl]-3,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 58457920 |
| Molecular Formula | C26H43ClN2O2 |
| Molecular Weight | 451.10 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (4S)-4-(4-chlorocyclohexen-1-yl)-1-[(2R)-2-[(4-methoxycyclohexa-2,4-dien-1-yl)methylamino]-3-methylbutyl]-3,3-dimethylpiperidin-4-ol |
| SMILES | COC1=CCC(CN[C@@H](CN2CC[C@](O)(C3=CCC(Cl)CC3)C(C)(C)C2)C(C)C)C=C1 |
| InChI | InChI=1S/C26H43ClN2O2/c1-19(2)24(28-16-20-6-12-23(31-5)13-7-20)17-29-15-14-26(30,25(3,4)18-29)21-8-10-22(27)11-9-21/h6,8,12-13,19-20,22,24,28,30H,7,9-11,14-18H2,1-5H3/t20?,22?,24-,26-/m0/s1 |
| InChIKey | XTYBIAOGSBNRKV-WVXCJSOBSA-N |
| XLogP | 4.89 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.10 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|