C27H49ClN2O — CID 58457931
[3-[[[(2R,3S)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 58457931) has the molecular formula C27H49ClN2O and a molecular weight of 453.16 g/mol. Its IUPAC name is [3-[[[(2R,3S)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [3-[[[(2R,3S)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 58457931 |
| Molecular Formula | C27H49ClN2O |
| Molecular Weight | 453.16 g/mol |
| Exact Mass | 452.35 |
| IUPAC Name | [3-[[[(2R,3S)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | CC[C@H](C)[C@H](CN1CCC(C2=CCC(Cl)CC2)C(C)(C)C1)NCC1CCCC(CO)C1 |
| InChI | InChI=1S/C27H49ClN2O/c1-5-20(2)26(29-16-21-7-6-8-22(15-21)18-31)17-30-14-13-25(27(3,4)19-30)23-9-11-24(28)12-10-23/h9,20-22,24-26,29,31H,5-8,10-19H2,1-4H3/t20-,21?,22?,24?,25?,26-/m0/s1 |
| InChIKey | MASQHXDKSIJBDC-KONDKKCESA-N |
| XLogP | 5.86 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.16 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|