C25H43ClN2 — CID 58457942
N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-methylcyclohexen-1-amine (PubChem CID 58457942) has the molecular formula C25H43ClN2 and a molecular weight of 407.09 g/mol. Its IUPAC name is N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-methylcyclohexen-1-amine.
| Compound Name | N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-methylcyclohexen-1-amine |
|---|---|
| PubChem CID | 58457942 |
| Molecular Formula | C25H43ClN2 |
| Molecular Weight | 407.09 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | N-[(2R)-1-[(4R)-4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]-3-methylcyclohexen-1-amine |
| SMILES | CC1C=C(N[C@@H](CN2CC[C@H](C3C=CC(Cl)CC3)C(C)(C)C2)C(C)C)CCC1 |
| InChI | InChI=1S/C25H43ClN2/c1-18(2)24(27-22-8-6-7-19(3)15-22)16-28-14-13-23(25(4,5)17-28)20-9-11-21(26)12-10-20/h9,11,15,18-21,23-24,27H,6-8,10,12-14,16-17H2,1-5H3/t19?,20?,21?,23-,24+/m1/s1 |
| InChIKey | TVKNZDCENSIHFF-OMZQIUPESA-N |
| XLogP | 6.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|