C28H49ClN4 — CID 58457947
(2R)-N-[3-(2,3,3a,4,5,7a-hexahydro-1H-benzimidazol-2-yl)propyl]-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-amine (PubChem CID 58457947) has the molecular formula C28H49ClN4 and a molecular weight of 477.18 g/mol. Its IUPAC name is (2R)-N-[3-(2,3,3a,4,5,7a-hexahydro-1H-benzimidazol-2-yl)propyl]-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-amine.
| Compound Name | (2R)-N-[3-(2,3,3a,4,5,7a-hexahydro-1H-benzimidazol-2-yl)propyl]-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 58457947 |
| Molecular Formula | C28H49ClN4 |
| Molecular Weight | 477.18 g/mol |
| Exact Mass | 476.36 |
| IUPAC Name | (2R)-N-[3-(2,3,3a,4,5,7a-hexahydro-1H-benzimidazol-2-yl)propyl]-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-amine |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NCCCC1NC2C=CCCC2N1 |
| InChI | InChI=1S/C28H49ClN4/c1-20(2)26(30-16-7-10-27-31-24-8-5-6-9-25(24)32-27)18-33-17-15-23(28(3,4)19-33)21-11-13-22(29)14-12-21/h5,8,11,13,20-27,30-32H,6-7,9-10,12,14-19H2,1-4H3/t21?,22?,23?,24?,25?,26-,27?/m0/s1 |
| InChIKey | VDJYMECNUJCDEM-JGYLGJOMSA-N |
| XLogP | 4.91 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.18 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|