C27H50ClN3O — CID 58457977
[3-[[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methylamino]methyl]cyclohexyl]methanol (PubChem CID 58457977) has the molecular formula C27H50ClN3O and a molecular weight of 468.17 g/mol. Its IUPAC name is [3-[[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methylamino]methyl]cyclohexyl]methanol.
| Compound Name | [3-[[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methylamino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 58457977 |
| Molecular Formula | C27H50ClN3O |
| Molecular Weight | 468.17 g/mol |
| Exact Mass | 467.36 |
| IUPAC Name | [3-[[[[(2R)-1-[4-(4-chlorocyclohexen-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methylamino]methyl]cyclohexyl]methanol |
| SMILES | CC(C)[C@H](CN1CCC(C2=CCC(Cl)CC2)C(C)(C)C1)NCNCC1CCCC(CO)C1 |
| InChI | InChI=1S/C27H50ClN3O/c1-20(2)26(30-19-29-15-21-6-5-7-22(14-21)17-32)16-31-13-12-25(27(3,4)18-31)23-8-10-24(28)11-9-23/h8,20-22,24-26,29-30,32H,5-7,9-19H2,1-4H3/t21?,22?,24?,25?,26-/m0/s1 |
| InChIKey | XCJUTUIUNQZZPL-ZGUKRASKSA-N |
| XLogP | 5.01 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.17 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|