C27H50ClN3O — CID 58458013
(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[(6-propoxypiperidin-3-yl)methyl]butan-2-amine (PubChem CID 58458013) has the molecular formula C27H50ClN3O and a molecular weight of 468.17 g/mol. Its IUPAC name is (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[(6-propoxypiperidin-3-yl)methyl]butan-2-amine.
| Compound Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[(6-propoxypiperidin-3-yl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 58458013 |
| Molecular Formula | C27H50ClN3O |
| Molecular Weight | 468.17 g/mol |
| Exact Mass | 467.36 |
| IUPAC Name | (2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methyl-N-[(6-propoxypiperidin-3-yl)methyl]butan-2-amine |
| SMILES | CCCOC1CCC(CN[C@@H](CN2CCC(C3C=CC(Cl)CC3)C(C)(C)C2)C(C)C)CN1 |
| InChI | InChI=1S/C27H50ClN3O/c1-6-15-32-26-12-7-21(17-30-26)16-29-25(20(2)3)18-31-14-13-24(27(4,5)19-31)22-8-10-23(28)11-9-22/h8,10,20-26,29-30H,6-7,9,11-19H2,1-5H3/t21?,22?,23?,24?,25-,26?/m0/s1 |
| InChIKey | FHKSAXFJBMTGCO-BXVMBYABSA-N |
| XLogP | 5.27 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.17 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|