C26H47ClN2O — CID 58458089
[3-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol (PubChem CID 58458089) has the molecular formula C26H47ClN2O and a molecular weight of 439.13 g/mol. Its IUPAC name is [3-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [3-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 58458089 |
| Molecular Formula | C26H47ClN2O |
| Molecular Weight | 439.13 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | [3-[[[(2R)-1-[4-(4-chlorocyclohex-2-en-1-yl)-3,3-dimethylpiperidin-1-yl]-3-methylbutan-2-yl]amino]methyl]cyclohexyl]methanol |
| SMILES | CC(C)[C@H](CN1CCC(C2C=CC(Cl)CC2)C(C)(C)C1)NCC1CCCC(CO)C1 |
| InChI | InChI=1S/C26H47ClN2O/c1-19(2)25(28-15-20-6-5-7-21(14-20)17-30)16-29-13-12-24(26(3,4)18-29)22-8-10-23(27)11-9-22/h8,10,19-25,28,30H,5-7,9,11-18H2,1-4H3/t20?,21?,22?,23?,24?,25-/m0/s1 |
| InChIKey | POOMJNBIMZLKNI-MPILJKFISA-N |
| XLogP | 5.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.13 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|