About (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine
(2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine (PubChem CID 58458195) has the molecular formula C21H30BrN
and a molecular weight of 376.38 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine.
Molecular Properties
| Compound Name | (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine |
| PubChem CID | 58458195 |
| Molecular Formula | C21H30BrN |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine |
| SMILES | C=C(C(C)C)[C@H](CN(CC1CC1)CC1CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H30BrN/c1-15(2)16(3)21(19-8-10-20(22)11-9-19)14-23(12-17-4-5-17)13-18-6-7-18/h8-11,15,17-18,21H,3-7,12-14H2,1-2H3/t21-/m0/s1 |
| InChIKey | LVXHLAWFQGXSRX-NRFANRHFSA-N |
| XLogP | 5.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine?
The IUPAC name of (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine (CID 58458195) is (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine.
What is the SMILES notation for (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine?
The canonical SMILES for (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine is C=C(C(C)C)[C@H](CN(CC1CC1)CC1CC1)c1ccc(Br)cc1.
What is the InChIKey of (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine?
The InChIKey is LVXHLAWFQGXSRX-NRFANRHFSA-N. The full InChI is InChI=1S/C21H30BrN/c1-15(2)16(3)21(19-8-10-20(22)11-9-19)14-23(12-17-4-5-17)13-18-6-7-18/h8-11,15,17-18,21H,3-7,12-14H2,1-2H3/t21-/m0/s1.
What are the key properties of (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine?
(2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine has a molecular weight of 376.38 g/mol, XLogP of 5.87, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4-bromophenyl)-N,N-bis(cyclopropylmethyl)-4-methyl-3-methylidenepentan-1-amine is sourced from PubChem (CID 58458195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).