About 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole
4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole (PubChem CID 58458804) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole.
Molecular Properties
| Compound Name | 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole |
| PubChem CID | 58458804 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole |
| SMILES | Cc1cc(C)c(-c2c(C)nn(C)c2C)s1 |
| InChI | InChI=1S/C12H16N2S/c1-7-6-8(2)15-12(7)11-9(3)13-14(5)10(11)4/h6H,1-5H3 |
| InChIKey | XVFVQCVPSSCLEG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole?
The IUPAC name of 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole (CID 58458804) is 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole.
What is the SMILES notation for 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole?
The canonical SMILES for 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole is Cc1cc(C)c(-c2c(C)nn(C)c2C)s1.
What is the InChIKey of 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole?
The InChIKey is XVFVQCVPSSCLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S/c1-7-6-8(2)15-12(7)11-9(3)13-14(5)10(11)4/h6H,1-5H3.
What are the key properties of 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole?
4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole has a molecular weight of 220.34 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylthiophen-2-yl)-1,3,5-trimethylpyrazole is sourced from PubChem (CID 58458804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).