About 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine
8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine (PubChem CID 58459090) has the molecular formula C23H31ClN6O2
and a molecular weight of 458.99 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine.
Molecular Properties
| Compound Name | 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine |
| PubChem CID | 58459090 |
| Molecular Formula | C23H31ClN6O2 |
| Molecular Weight | 458.99 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine |
| SMILES | CCN1CCN(c2nc(C)nc3c2nc(-c2ccccc2Cl)n3C(COC)COC)CC1 |
| InChI | InChI=1S/C23H31ClN6O2/c1-5-28-10-12-29(13-11-28)22-20-23(26-16(2)25-22)30(17(14-31-3)15-32-4)21(27-20)18-8-6-7-9-19(18)24/h6-9,17H,5,10-15H2,1-4H3 |
| InChIKey | RNIPCZJSAUJLLI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.99 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine?
The IUPAC name of 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine (CID 58459090) is 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine.
What is the SMILES notation for 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine?
The canonical SMILES for 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine is CCN1CCN(c2nc(C)nc3c2nc(-c2ccccc2Cl)n3C(COC)COC)CC1.
What is the InChIKey of 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine?
The InChIKey is RNIPCZJSAUJLLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31ClN6O2/c1-5-28-10-12-29(13-11-28)22-20-23(26-16(2)25-22)30(17(14-31-3)15-32-4)21(27-20)18-8-6-7-9-19(18)24/h6-9,17H,5,10-15H2,1-4H3.
What are the key properties of 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine?
8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine has a molecular weight of 458.99 g/mol, XLogP of 3.43, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-chlorophenyl)-9-(1,3-dimethoxypropan-2-yl)-6-(4-ethylpiperazin-1-yl)-2-methylpurine is sourced from PubChem (CID 58459090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).