About 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine
5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine (PubChem CID 58459653) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine.
Molecular Properties
| Compound Name | 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine |
| PubChem CID | 58459653 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine |
| SMILES | C=C1CCC(C(C)(C)C)=C(C(C)(C)C)N1 |
| InChI | InChI=1S/C14H25N/c1-10-8-9-11(13(2,3)4)12(15-10)14(5,6)7/h15H,1,8-9H2,2-7H3 |
| InChIKey | BTSWLVMIEAOGRF-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine?
The IUPAC name of 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine (CID 58459653) is 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine.
What is the SMILES notation for 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine?
The canonical SMILES for 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine is C=C1CCC(C(C)(C)C)=C(C(C)(C)C)N1.
What is the InChIKey of 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine?
The InChIKey is BTSWLVMIEAOGRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-10-8-9-11(13(2,3)4)12(15-10)14(5,6)7/h15H,1,8-9H2,2-7H3.
What are the key properties of 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine?
5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine has a molecular weight of 207.36 g/mol, XLogP of 4.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-ditert-butyl-2-methylidene-3,4-dihydro-1H-pyridine is sourced from PubChem (CID 58459653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).