C21H22N2O2S2 — CID 58459694
N-[5-[benzoyl(methyl)amino]-2,4-bis(sulfanylidene)pentyl]-N-methylbenzamide (PubChem CID 58459694) has the molecular formula C21H22N2O2S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is N-[5-[benzoyl(methyl)amino]-2,4-bis(sulfanylidene)pentyl]-N-methylbenzamide.
| Compound Name | N-[5-[benzoyl(methyl)amino]-2,4-bis(sulfanylidene)pentyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 58459694 |
| Molecular Formula | C21H22N2O2S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[5-[benzoyl(methyl)amino]-2,4-bis(sulfanylidene)pentyl]-N-methylbenzamide |
| SMILES | CN(CC(=S)CC(=S)CN(C)C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2S2/c1-22(20(24)16-9-5-3-6-10-16)14-18(26)13-19(27)15-23(2)21(25)17-11-7-4-8-12-17/h3-12H,13-15H2,1-2H3 |
| InChIKey | HYDXPSQVRZQRLL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|