About 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one
3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one (PubChem CID 58459923) has the molecular formula C22H16O3
and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one |
| PubChem CID | 58459923 |
| Molecular Formula | C22H16O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2ccc(-c3ccccc3)cc2CC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16O3/c23-21(16-9-5-2-6-10-16)19-14-18-13-17(15-7-3-1-4-8-15)11-12-20(18)25-22(19)24/h1-13,19H,14H2 |
| InChIKey | HMDJVMBXXYUKKE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one?
The IUPAC name of 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one (CID 58459923) is 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one.
What is the SMILES notation for 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one?
The canonical SMILES for 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one is O=C1Oc2ccc(-c3ccccc3)cc2CC1C(=O)c1ccccc1.
What is the InChIKey of 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one?
The InChIKey is HMDJVMBXXYUKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16O3/c23-21(16-9-5-2-6-10-16)19-14-18-13-17(15-7-3-1-4-8-15)11-12-20(18)25-22(19)24/h1-13,19H,14H2.
What are the key properties of 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one?
3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one has a molecular weight of 328.37 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-6-phenyl-3,4-dihydrochromen-2-one is sourced from PubChem (CID 58459923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).