C17H19NO4P2 — CID 58459945
(4R,4aS,12bS)-3-methyl-4a-phosphanyloxy-9-phosphoroso-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 58459945) has the molecular formula C17H19NO4P2 and a molecular weight of 363.29 g/mol. Its IUPAC name is (4R,4aS,12bS)-3-methyl-4a-phosphanyloxy-9-phosphoroso-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,12bS)-3-methyl-4a-phosphanyloxy-9-phosphoroso-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 58459945 |
| Molecular Formula | C17H19NO4P2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | (4R,4aS,12bS)-3-methyl-4a-phosphanyloxy-9-phosphoroso-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | CN1CC[C@]23c4c5ccc(P=O)c4OC2C(=O)CC[C@@]3(OP)[C@H]1C5 |
| InChI | InChI=1S/C17H19NO4P2/c1-18-7-6-16-13-9-2-3-11(24-20)14(13)21-15(16)10(19)4-5-17(16,22-23)12(18)8-9/h2-3,12,15H,4-8,23H2,1H3/t12-,15?,16+,17-/m1/s1 |
| InChIKey | RWTSWUQHTGHCOE-VSYOVCOZSA-N |
| XLogP | 1.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|