About (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione
(3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione (PubChem CID 58460097) has the molecular formula C20H13NO3S
and a molecular weight of 347.40 g/mol. Its IUPAC name is (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione.
Molecular Properties
| Compound Name | (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione |
| PubChem CID | 58460097 |
| Molecular Formula | C20H13NO3S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione |
| SMILES | O=C1Oc2ccccc2C(=O)/C1=C/Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H13NO3S/c22-19-14-8-4-5-9-17(14)24-20(23)15(19)10-11-18-21-16(12-25-18)13-6-2-1-3-7-13/h1-10,12H,11H2/b15-10- |
| InChIKey | YXUPKNHRBWEFJQ-GDNBJRDFSA-N |
| XLogP | 4.08 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione?
The IUPAC name of (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione (CID 58460097) is (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione.
What is the SMILES notation for (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione?
The canonical SMILES for (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione is O=C1Oc2ccccc2C(=O)/C1=C/Cc1nc(-c2ccccc2)cs1.
What is the InChIKey of (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione?
The InChIKey is YXUPKNHRBWEFJQ-GDNBJRDFSA-N. The full InChI is InChI=1S/C20H13NO3S/c22-19-14-8-4-5-9-17(14)24-20(23)15(19)10-11-18-21-16(12-25-18)13-6-2-1-3-7-13/h1-10,12H,11H2/b15-10-.
What are the key properties of (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione?
(3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione has a molecular weight of 347.40 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[2-(4-phenyl-1,3-thiazol-2-yl)ethylidene]chromene-2,4-dione is sourced from PubChem (CID 58460097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).