About 2,3-dimethylbuta-1,3-diene;pentakis(yttrium)
2,3-dimethylbuta-1,3-diene;pentakis(yttrium) (PubChem CID 58460586) has the molecular formula C6H8Y5-2
and a molecular weight of 524.66 g/mol. Its IUPAC name is 2,3-dimethylbuta-1,3-diene;pentakis(yttrium).
Molecular Properties
| Compound Name | 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) |
| PubChem CID | 58460586 |
| Molecular Formula | C6H8Y5-2 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.59 |
| IUPAC Name | 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) |
| SMILES | [H]/[C-]=C(C)\C(C)=[C-]/[H].[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C6H8.5Y/c1-5(2)6(3)4;;;;;/h1,3H,2,4H3;;;;;/q-2;;;;; |
| InChIKey | HXEXNYLKXXFVOP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbuta-1,3-diene;pentakis(yttrium)?
The IUPAC name of 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) (CID 58460586) is 2,3-dimethylbuta-1,3-diene;pentakis(yttrium).
What is the SMILES notation for 2,3-dimethylbuta-1,3-diene;pentakis(yttrium)?
The canonical SMILES for 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) is [H]/[C-]=C(C)\C(C)=[C-]/[H].[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 2,3-dimethylbuta-1,3-diene;pentakis(yttrium)?
The InChIKey is HXEXNYLKXXFVOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8.5Y/c1-5(2)6(3)4;;;;;/h1,3H,2,4H3;;;;;/q-2;;;;;.
What are the key properties of 2,3-dimethylbuta-1,3-diene;pentakis(yttrium)?
2,3-dimethylbuta-1,3-diene;pentakis(yttrium) has a molecular weight of 524.66 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbuta-1,3-diene;pentakis(yttrium) is sourced from PubChem (CID 58460586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).