C22H28FNO3S — CID 58460929
(3S,4R,5R)-5-(3-aminophenyl)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 58460929) has the molecular formula C22H28FNO3S and a molecular weight of 405.54 g/mol. Its IUPAC name is (3S,4R,5R)-5-(3-aminophenyl)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (3S,4R,5R)-5-(3-aminophenyl)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 58460929 |
| Molecular Formula | C22H28FNO3S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (3S,4R,5R)-5-(3-aminophenyl)-3-butyl-3-ethyl-7-fluoro-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2ccc(F)cc2[C@@H](c2cccc(N)c2)[C@H]1O |
| InChI | InChI=1S/C22H28FNO3S/c1-3-5-11-22(4-2)14-28(26,27)19-10-9-16(23)13-18(19)20(21(22)25)15-7-6-8-17(24)12-15/h6-10,12-13,20-21,25H,3-5,11,14,24H2,1-2H3/t20-,21-,22-/m1/s1 |
| InChIKey | SNTNTVMNPPHCPY-YPAWHYETSA-N |
| XLogP | 4.27 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|