C22H26FNO5S — CID 58460934
(3R,4S,5S)-3-butyl-3-ethyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol (PubChem CID 58460934) has the molecular formula C22H26FNO5S and a molecular weight of 435.52 g/mol. Its IUPAC name is (3R,4S,5S)-3-butyl-3-ethyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol.
| Compound Name | (3R,4S,5S)-3-butyl-3-ethyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
|---|---|
| PubChem CID | 58460934 |
| Molecular Formula | C22H26FNO5S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (3R,4S,5S)-3-butyl-3-ethyl-7-fluoro-5-(3-nitrophenyl)-1,1-dioxo-4,5-dihydro-2H-1λ6-benzothiepin-4-ol |
| SMILES | CCCC[C@@]1(CC)CS(=O)(=O)c2ccc(F)cc2[C@H](c2cccc([N+](=O)[O-])c2)[C@@H]1O |
| InChI | InChI=1S/C22H26FNO5S/c1-3-5-11-22(4-2)14-30(28,29)19-10-9-16(23)13-18(19)20(21(22)25)15-7-6-8-17(12-15)24(26)27/h6-10,12-13,20-21,25H,3-5,11,14H2,1-2H3/t20-,21-,22-/m0/s1 |
| InChIKey | SVFWKJXLQIDAOB-FKBYEOEOSA-N |
| XLogP | 4.60 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|