C12H22O6 — CID 58461006
(3R,4R,6S)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylpent-4-enyl)oxane-3,4,5-triol (PubChem CID 58461006) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (3R,4R,6S)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylpent-4-enyl)oxane-3,4,5-triol.
| Compound Name | (3R,4R,6S)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylpent-4-enyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 58461006 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3R,4R,6S)-2-(hydroxymethyl)-6-(2-hydroxy-2-methylpent-4-enyl)oxane-3,4,5-triol |
| SMILES | C=CCC(C)(O)C[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C12H22O6/c1-3-4-12(2,17)5-7-9(14)11(16)10(15)8(6-13)18-7/h3,7-11,13-17H,1,4-6H2,2H3/t7-,8?,9?,10-,11+,12?/m0/s1 |
| InChIKey | NHWIDMVVZCTASX-VGSQVRSXSA-N |
| XLogP | -1.45 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|