C30H30F3N3O8 — CID 58461219
(4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[4-(trifluoromethoxy)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58461219) has the molecular formula C30H30F3N3O8 and a molecular weight of 617.58 g/mol. Its IUPAC name is (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[4-(trifluoromethoxy)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[4-(trifluoromethoxy)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58461219 |
| Molecular Formula | C30H30F3N3O8 |
| Molecular Weight | 617.58 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | (4aR,5aS,12aS)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-9-[4-(trifluoromethoxy)phenyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(OC(F)(F)F)cc2)c(O)c2c1C[C@@H]1C[C@@H]3C(N(C)C)C(=O)C(C(N)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C30H30F3N3O8/c1-35(2)18-11-15(12-5-7-14(8-6-12)44-30(31,32)33)23(37)20-16(18)9-13-10-17-22(36(3)4)25(39)21(28(34)42)27(41)29(17,43)26(40)19(13)24(20)38/h5-8,11,13,17,22,37-38,41,43H,9-10H2,1-4H3,(H2,34,42)/t13-,17-,22?,29-/m1/s1 |
| InChIKey | ZOEQQQZCHHRJHX-YQIVHWSTSA-N |
| XLogP | 2.60 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.58 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|