C19H28O2Si — CID 58461591
ethyl (6E,8E,10R)-10-methyl-13-trimethylsilyltrideca-6,8-dien-4,12-diynoate (PubChem CID 58461591) has the molecular formula C19H28O2Si and a molecular weight of 316.52 g/mol. Its IUPAC name is ethyl (6E,8E,10R)-10-methyl-13-trimethylsilyltrideca-6,8-dien-4,12-diynoate.
| Compound Name | ethyl (6E,8E,10R)-10-methyl-13-trimethylsilyltrideca-6,8-dien-4,12-diynoate |
|---|---|
| PubChem CID | 58461591 |
| Molecular Formula | C19H28O2Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | ethyl (6E,8E,10R)-10-methyl-13-trimethylsilyltrideca-6,8-dien-4,12-diynoate |
| SMILES | CCOC(=O)CCC#C/C=C/C=C/[C@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H28O2Si/c1-6-21-19(20)16-12-10-8-7-9-11-14-18(2)15-13-17-22(3,4)5/h7,9,11,14,18H,6,12,15-16H2,1-5H3/b9-7+,14-11+/t18-/m0/s1 |
| InChIKey | HTUUGZBKNYEPHV-MWRMJNJPSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|