C17H31IOSi2 — CID 58461593
tert-butyl-[(4R,5E,7E)-8-iodo-1-trimethylsilylocta-5,7-dien-1-yn-4-yl]oxy-dimethylsilane (PubChem CID 58461593) has the molecular formula C17H31IOSi2 and a molecular weight of 434.51 g/mol. Its IUPAC name is tert-butyl-[(4R,5E,7E)-8-iodo-1-trimethylsilylocta-5,7-dien-1-yn-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,5E,7E)-8-iodo-1-trimethylsilylocta-5,7-dien-1-yn-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58461593 |
| Molecular Formula | C17H31IOSi2 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | tert-butyl-[(4R,5E,7E)-8-iodo-1-trimethylsilylocta-5,7-dien-1-yn-4-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/C=C/I)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C17H31IOSi2/c1-17(2,3)21(7,8)19-16(12-9-10-14-18)13-11-15-20(4,5)6/h9-10,12,14,16H,13H2,1-8H3/b12-9+,14-10+/t16-/m0/s1 |
| InChIKey | ZYRAVOBQWIPVRU-VBDKHZPGSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|