C21H32O2Si — CID 58461595
methyl (5R,8E,10E,12R)-5,12-dimethyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58461595) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is methyl (5R,8E,10E,12R)-5,12-dimethyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | methyl (5R,8E,10E,12R)-5,12-dimethyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58461595 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | methyl (5R,8E,10E,12R)-5,12-dimethyl-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | COC(=O)CCC[C@@H](C)C#C/C=C/C=C/[C@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C21H32O2Si/c1-19(15-11-17-21(22)23-3)13-9-7-8-10-14-20(2)16-12-18-24(4,5)6/h7-8,10,14,19-20H,11,15-17H2,1-6H3/b8-7+,14-10+/t19-,20-/m0/s1 |
| InChIKey | ASQOHLOUJCLQHW-QZJCOXGYSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|