C19H28O2Si — CID 58461601
methyl (8E,10E)-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58461601) has the molecular formula C19H28O2Si and a molecular weight of 316.52 g/mol. Its IUPAC name is methyl (8E,10E)-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | methyl (8E,10E)-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58461601 |
| Molecular Formula | C19H28O2Si |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | methyl (8E,10E)-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | COC(=O)CCCCC#C/C=C/C=C/CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H28O2Si/c1-21-19(20)17-15-13-11-9-7-5-6-8-10-12-14-16-18-22(2,3)4/h5-6,8,10H,11-15,17H2,1-4H3/b6-5+,10-8+ |
| InChIKey | OONORSFOYFYDJM-FTKIWFIZSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|