C22H36O2 — CID 58461615
[(1S,3R,7S,8aR)-8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 58461615) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is [(1S,3R,7S,8aR)-8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8aR)-8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58461615 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | [(1S,3R,7S,8aR)-8-tert-butyl-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)C(C(C)(C)C)[C@H]21 |
| InChI | InChI=1S/C22H36O2/c1-9-22(7,8)20(23)24-17-13-14(2)12-16-11-10-15(3)19(18(16)17)21(4,5)6/h10-12,14-15,17-19H,9,13H2,1-8H3/t14-,15-,17-,18+,19?/m0/s1 |
| InChIKey | FVEFIGIIYNWFFZ-LQJGXABVSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |