C36H46F2O3Si2 — CID 58461648
ethyl (8E,10E,12R)-12-[tert-butyl(diphenyl)silyl]oxy-5,5-difluoro-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate (PubChem CID 58461648) has the molecular formula C36H46F2O3Si2 and a molecular weight of 620.93 g/mol. Its IUPAC name is ethyl (8E,10E,12R)-12-[tert-butyl(diphenyl)silyl]oxy-5,5-difluoro-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate.
| Compound Name | ethyl (8E,10E,12R)-12-[tert-butyl(diphenyl)silyl]oxy-5,5-difluoro-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
|---|---|
| PubChem CID | 58461648 |
| Molecular Formula | C36H46F2O3Si2 |
| Molecular Weight | 620.93 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | ethyl (8E,10E,12R)-12-[tert-butyl(diphenyl)silyl]oxy-5,5-difluoro-15-trimethylsilylpentadeca-8,10-dien-6,14-diynoate |
| SMILES | CCOC(=O)CCCC(F)(F)C#C/C=C/C=C/[C@@H](CC#C[Si](C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H46F2O3Si2/c1-8-40-34(39)27-19-29-36(37,38)28-18-10-9-13-21-31(22-20-30-42(5,6)7)41-43(35(2,3)4,32-23-14-11-15-24-32)33-25-16-12-17-26-33/h9-17,21,23-26,31H,8,19,22,27,29H2,1-7H3/b10-9+,21-13+/t31-/m0/s1 |
| InChIKey | NSMMZCLCORVDOZ-GEGGEUSMSA-N |
| XLogP | 7.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.93 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|