C19H32O2Si — CID 58461666
(5S,6Z,8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-6,8,10-trien-14-yne-1,5-diol (PubChem CID 58461666) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (5S,6Z,8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-6,8,10-trien-14-yne-1,5-diol.
| Compound Name | (5S,6Z,8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-6,8,10-trien-14-yne-1,5-diol |
|---|---|
| PubChem CID | 58461666 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (5S,6Z,8E,10E,12R)-12-methyl-15-trimethylsilylpentadeca-6,8,10-trien-14-yne-1,5-diol |
| SMILES | C[C@@H](/C=C/C=C/C=C\[C@@H](O)CCCCO)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H32O2Si/c1-18(13-11-17-22(2,3)4)12-7-5-6-8-14-19(21)15-9-10-16-20/h5-8,12,14,18-21H,9-10,13,15-16H2,1-4H3/b6-5+,12-7+,14-8-/t18-,19+/m0/s1 |
| InChIKey | QDPVPMIWWPLCON-TUAWHBKKSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|