C22H36O2Si — CID 58461673
methyl (6Z,8E,10E,12R)-5,7,12-trimethyl-15-trimethylsilylpentadeca-6,8,10-trien-14-ynoate (PubChem CID 58461673) has the molecular formula C22H36O2Si and a molecular weight of 360.61 g/mol. Its IUPAC name is methyl (6Z,8E,10E,12R)-5,7,12-trimethyl-15-trimethylsilylpentadeca-6,8,10-trien-14-ynoate.
| Compound Name | methyl (6Z,8E,10E,12R)-5,7,12-trimethyl-15-trimethylsilylpentadeca-6,8,10-trien-14-ynoate |
|---|---|
| PubChem CID | 58461673 |
| Molecular Formula | C22H36O2Si |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | methyl (6Z,8E,10E,12R)-5,7,12-trimethyl-15-trimethylsilylpentadeca-6,8,10-trien-14-ynoate |
| SMILES | COC(=O)CCCC(C)/C=C(C)\C=C\C=C\[C@H](C)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C22H36O2Si/c1-19(15-11-17-25(5,6)7)12-8-9-13-20(2)18-21(3)14-10-16-22(23)24-4/h8-9,12-13,18-19,21H,10,14-16H2,1-7H3/b12-8+,13-9+,20-18-/t19-,21?/m0/s1 |
| InChIKey | LMLKNHPWGADTDN-KOHKPKDLSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|