C24H22N6O2S2 — CID 58462216
5,6-dimethyl-12,13-bis(methylsulfinyl)-2,9-diphenyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene (PubChem CID 58462216) has the molecular formula C24H22N6O2S2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 5,6-dimethyl-12,13-bis(methylsulfinyl)-2,9-diphenyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene.
| Compound Name | 5,6-dimethyl-12,13-bis(methylsulfinyl)-2,9-diphenyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene |
|---|---|
| PubChem CID | 58462216 |
| Molecular Formula | C24H22N6O2S2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 5,6-dimethyl-12,13-bis(methylsulfinyl)-2,9-diphenyl-2,4,7,9,11,14-hexazatricyclo[8.4.0.03,8]tetradeca-1(10),3,5,7,11,13-hexaene |
| SMILES | Cc1nc2c(nc1C)N(c1ccccc1)c1nc(S(C)=O)c(S(C)=O)nc1N2c1ccccc1 |
| InChI | InChI=1S/C24H22N6O2S2/c1-15-16(2)26-20-19(25-15)29(17-11-7-5-8-12-17)21-22(30(20)18-13-9-6-10-14-18)28-24(34(4)32)23(27-21)33(3)31/h5-14H,1-4H3 |
| InChIKey | WBTQEYJKNMHQRT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 92.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |