C54H38F6N6 — CID 58462241
2,5,6,9-tetrakis(4-methylphenyl)-14,15-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12(17),13,15-octaene (PubChem CID 58462241) has the molecular formula C54H38F6N6 and a molecular weight of 884.93 g/mol. Its IUPAC name is 2,5,6,9-tetrakis(4-methylphenyl)-14,15-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12(17),13,15-octaene.
| Compound Name | 2,5,6,9-tetrakis(4-methylphenyl)-14,15-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12(17),13,15-octaene |
|---|---|
| PubChem CID | 58462241 |
| Molecular Formula | C54H38F6N6 |
| Molecular Weight | 884.93 g/mol |
| Exact Mass | 884.31 |
| IUPAC Name | 2,5,6,9-tetrakis(4-methylphenyl)-14,15-bis[4-(trifluoromethyl)phenyl]-2,4,7,9,11,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12(17),13,15-octaene |
| SMILES | Cc1ccc(-c2nc3c(nc2-c2ccc(C)cc2)N(c2ccc(C)cc2)c2nc4cc(-c5ccc(C(F)(F)F)cc5)c(-c5ccc(C(F)(F)F)cc5)cc4nc2N3c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C54H38F6N6/c1-31-5-13-37(14-6-31)47-48(38-15-7-32(2)8-16-38)64-52-51(63-47)65(41-25-9-33(3)10-26-41)49-50(66(52)42-27-11-34(4)12-28-42)62-46-30-44(36-19-23-40(24-20-36)54(58,59)60)43(29-45(46)61-49)35-17-21-39(22-18-35)53(55,56)57/h5-30H,1-4H3 |
| InChIKey | DZTGWWSLAGAGCC-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.93 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |