About 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane
4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane (PubChem CID 58462342) has the molecular formula C11H22O3
and a molecular weight of 202.29 g/mol. Its IUPAC name is 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane |
| PubChem CID | 58462342 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane |
| SMILES | COC1CC(C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C11H22O3/c1-10(2,3)8-7-9(12-6)14-11(4,5)13-8/h8-9H,7H2,1-6H3 |
| InChIKey | AYGVIMZCGXXLAL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane?
The IUPAC name of 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane (CID 58462342) is 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane.
What is the SMILES notation for 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane?
The canonical SMILES for 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane is COC1CC(C(C)(C)C)OC(C)(C)O1.
What is the InChIKey of 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane?
The InChIKey is AYGVIMZCGXXLAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O3/c1-10(2,3)8-7-9(12-6)14-11(4,5)13-8/h8-9H,7H2,1-6H3.
What are the key properties of 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane?
4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane has a molecular weight of 202.29 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-6-methoxy-2,2-dimethyl-1,3-dioxane is sourced from PubChem (CID 58462342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).