C37H37N6O5+ — CID 58462545
N-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide (PubChem CID 58462545) has the molecular formula C37H37N6O5+ and a molecular weight of 645.74 g/mol. Its IUPAC name is N-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide.
| Compound Name | N-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 58462545 |
| Molecular Formula | C37H37N6O5+ |
| Molecular Weight | 645.74 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | N-[4-[(1,4-dioxo-2,3-dihydrophthalazin-6-yl)-ethylamino]butyl]-3-[[4-[5-(4-methoxyphenyl)-1,3-oxazol-2-yl]pyridin-1-ium-1-yl]methyl]benzamide |
| SMILES | CCN(CCCCNC(=O)c1cccc(C[n+]2ccc(-c3ncc(-c4ccc(OC)cc4)o3)cc2)c1)c1ccc2c(=O)[nH][nH]c(=O)c2c1 |
| InChI | InChI=1S/C37H36N6O5/c1-3-43(29-11-14-31-32(22-29)36(46)41-40-35(31)45)18-5-4-17-38-34(44)28-8-6-7-25(21-28)24-42-19-15-27(16-20-42)37-39-23-33(48-37)26-9-12-30(47-2)13-10-26/h6-16,19-23,39H,3-5,17-18,24H2,1-2H3,(H,38,44)/p+1 |
| InChIKey | DBLQFSFLQPBNNZ-UHFFFAOYSA-O |
| XLogP | 4.92 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.74 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|