About 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine
5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine (PubChem CID 58462634) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine |
| PubChem CID | 58462634 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine |
| SMILES | CC(C)c1ncc(-c2ccc3c(C(C)C)c(C(C)C)ccc3c2)cn1 |
| InChI | InChI=1S/C23H28N2/c1-14(2)20-9-8-18-11-17(7-10-21(18)22(20)15(3)4)19-12-24-23(16(5)6)25-13-19/h7-16H,1-6H3 |
| InChIKey | WHJNIUFDVYSWCU-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine?
The IUPAC name of 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine (CID 58462634) is 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine.
What is the SMILES notation for 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine?
The canonical SMILES for 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine is CC(C)c1ncc(-c2ccc3c(C(C)C)c(C(C)C)ccc3c2)cn1.
What is the InChIKey of 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine?
The InChIKey is WHJNIUFDVYSWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2/c1-14(2)20-9-8-18-11-17(7-10-21(18)22(20)15(3)4)19-12-24-23(16(5)6)25-13-19/h7-16H,1-6H3.
What are the key properties of 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine?
5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine has a molecular weight of 332.49 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5,6-di(propan-2-yl)naphthalen-2-yl]-2-propan-2-ylpyrimidine is sourced from PubChem (CID 58462634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).