C21H38O6Si — CID 58462752
1-O-(2-methoxyethyl) 5-O-[2-(3-trimethylsilylprop-2-ynoxy)ethyl] 2-ethyl-2,4,4-trimethylpentanedioate (PubChem CID 58462752) has the molecular formula C21H38O6Si and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-O-(2-methoxyethyl) 5-O-[2-(3-trimethylsilylprop-2-ynoxy)ethyl] 2-ethyl-2,4,4-trimethylpentanedioate.
| Compound Name | 1-O-(2-methoxyethyl) 5-O-[2-(3-trimethylsilylprop-2-ynoxy)ethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 58462752 |
| Molecular Formula | C21H38O6Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-O-(2-methoxyethyl) 5-O-[2-(3-trimethylsilylprop-2-ynoxy)ethyl] 2-ethyl-2,4,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCOCC#C[Si](C)(C)C)C(=O)OCCOC |
| InChI | InChI=1S/C21H38O6Si/c1-9-21(4,19(23)27-14-12-24-5)17-20(2,3)18(22)26-15-13-25-11-10-16-28(6,7)8/h9,11-15,17H2,1-8H3 |
| InChIKey | JBHYNVMVQRHTKU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|