C15H13N3 — CID 58462768
7,8-dimethyl-2,3-dimethylidenepyrido[2,3-b][1,8]naphthyridine (PubChem CID 58462768) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 7,8-dimethyl-2,3-dimethylidenepyrido[2,3-b][1,8]naphthyridine.
| Compound Name | 7,8-dimethyl-2,3-dimethylidenepyrido[2,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 58462768 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 7,8-dimethyl-2,3-dimethylidenepyrido[2,3-b][1,8]naphthyridine |
| SMILES | C=c1cc2cc3cc(C)c(C)nc3nc2nc1=C |
| InChI | InChI=1S/C15H13N3/c1-8-5-12-7-13-6-9(2)11(4)17-15(13)18-14(12)16-10(8)3/h5-7H,1,3H2,2,4H3 |
| InChIKey | UKGMSHVKPMHNPB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|