About 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene
2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene (PubChem CID 58462783) has the molecular formula C15H25O3P
and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene |
| PubChem CID | 58462783 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(P(=O)(OC(C)C)OC(C)C)c(C)c1 |
| InChI | InChI=1S/C15H25O3P/c1-10(2)17-19(16,18-11(3)4)15-13(6)8-12(5)9-14(15)7/h8-11H,1-7H3 |
| InChIKey | QDULFJYGLHVRNG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene?
The IUPAC name of 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene (CID 58462783) is 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene?
The canonical SMILES for 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene is Cc1cc(C)c(P(=O)(OC(C)C)OC(C)C)c(C)c1.
What is the InChIKey of 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene?
The InChIKey is QDULFJYGLHVRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O3P/c1-10(2)17-19(16,18-11(3)4)15-13(6)8-12(5)9-14(15)7/h8-11H,1-7H3.
What are the key properties of 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene?
2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene has a molecular weight of 284.34 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-di(propan-2-yloxy)phosphoryl-1,3,5-trimethylbenzene is sourced from PubChem (CID 58462783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).