sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate

C4H5F4NaO4S — CID 58463092

IUPACsodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate
SMILESO=S(=O)([O-])C(F)(F)C(F)(F)CCO.[Na+]
InChIInChI=1S/C4H6F4O4S.Na/c5-3(6,1-2-9)4(7,8)13(10,11)12;/h9H,1-2H2,(H,10,11,12);/q;+1/p-1
InChIKeyHRJIMEINFSCMIT-UHFFFAOYSA-M
MW248.13 g/mol
LogP-2.85
Rot. Bonds4

About sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate

sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate (PubChem CID 58463092) has the molecular formula C4H5F4NaO4S and a molecular weight of 248.13 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate.

Molecular Properties

Compound Namesodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate
PubChem CID58463092
Molecular FormulaC4H5F4NaO4S
Molecular Weight248.13 g/mol
Exact Mass247.97
IUPAC Namesodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate
SMILESO=S(=O)([O-])C(F)(F)C(F)(F)CCO.[Na+]
InChIInChI=1S/C4H6F4O4S.Na/c5-3(6,1-2-9)4(7,8)13(10,11)12;/h9H,1-2H2,(H,10,11,12);/q;+1/p-1
InChIKeyHRJIMEINFSCMIT-UHFFFAOYSA-M
XLogP-2.85
TPSA77.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.13
LogP ≤ 5-2.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate?
The IUPAC name of sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate (CID 58463092) is sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate.
What is the SMILES notation for sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate?
The canonical SMILES for sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate is O=S(=O)([O-])C(F)(F)C(F)(F)CCO.[Na+].
What is the InChIKey of sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate?
The InChIKey is HRJIMEINFSCMIT-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6F4O4S.Na/c5-3(6,1-2-9)4(7,8)13(10,11)12;/h9H,1-2H2,(H,10,11,12);/q;+1/p-1.
What are the key properties of sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate?
sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate has a molecular weight of 248.13 g/mol, XLogP of -2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonate is sourced from PubChem (CID 58463092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).