1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid

C4H6F4O4S — CID 58463093

IUPAC1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)C(F)(F)CCO
InChIInChI=1S/C4H6F4O4S/c5-3(6,1-2-9)4(7,8)13(10,11)12/h9H,1-2H2,(H,10,11,12)
InChIKeyFMWOQCFGKLGVLR-UHFFFAOYSA-N
MW226.15 g/mol
LogP0.48
Rot. Bonds4

About 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid

1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid (PubChem CID 58463093) has the molecular formula C4H6F4O4S and a molecular weight of 226.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid.

Molecular Properties

Compound Name1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid
PubChem CID58463093
Molecular FormulaC4H6F4O4S
Molecular Weight226.15 g/mol
Exact Mass225.99
IUPAC Name1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid
SMILESO=S(=O)(O)C(F)(F)C(F)(F)CCO
InChIInChI=1S/C4H6F4O4S/c5-3(6,1-2-9)4(7,8)13(10,11)12/h9H,1-2H2,(H,10,11,12)
InChIKeyFMWOQCFGKLGVLR-UHFFFAOYSA-N
XLogP0.48
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.15
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid?
The IUPAC name of 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid (CID 58463093) is 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid.
What is the SMILES notation for 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid?
The canonical SMILES for 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid is O=S(=O)(O)C(F)(F)C(F)(F)CCO.
What is the InChIKey of 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid?
The InChIKey is FMWOQCFGKLGVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F4O4S/c5-3(6,1-2-9)4(7,8)13(10,11)12/h9H,1-2H2,(H,10,11,12).
What are the key properties of 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid?
1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid has a molecular weight of 226.15 g/mol, XLogP of 0.48, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfonic acid is sourced from PubChem (CID 58463093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).