C15H21NO3 — CID 58463456
N-[dideuterio-(3-methylphenyl)methyl]-4-oxo-2-(trideuteriomethoxymethyl)pentanamide (PubChem CID 58463456) has the molecular formula C15H21NO3 and a molecular weight of 268.37 g/mol. Its IUPAC name is N-[dideuterio-(3-methylphenyl)methyl]-4-oxo-2-(trideuteriomethoxymethyl)pentanamide.
| Compound Name | N-[dideuterio-(3-methylphenyl)methyl]-4-oxo-2-(trideuteriomethoxymethyl)pentanamide |
|---|---|
| PubChem CID | 58463456 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-[dideuterio-(3-methylphenyl)methyl]-4-oxo-2-(trideuteriomethoxymethyl)pentanamide |
| SMILES | [2H]C([2H])([2H])OCC(CC(C)=O)C(=O)NC([2H])([2H])c1cccc(C)c1 |
| InChI | InChI=1S/C15H21NO3/c1-11-5-4-6-13(7-11)9-16-15(18)14(10-19-3)8-12(2)17/h4-7,14H,8-10H2,1-3H3,(H,16,18)/i3D3,9D2 |
| InChIKey | RVXBAOWMTDQCIC-IIVFXWFJSA-N |
| XLogP | 1.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |