C27H30F3IN2O3 — CID 58463896
N-[3-[(3S)-1-[4-hydroxy-4-(4-iodophenyl)cyclohexyl]pyrrolidin-3-yl]-2-oxopropyl]-3-(trifluoromethyl)benzamide (PubChem CID 58463896) has the molecular formula C27H30F3IN2O3 and a molecular weight of 614.45 g/mol. Its IUPAC name is N-[3-[(3S)-1-[4-hydroxy-4-(4-iodophenyl)cyclohexyl]pyrrolidin-3-yl]-2-oxopropyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[3-[(3S)-1-[4-hydroxy-4-(4-iodophenyl)cyclohexyl]pyrrolidin-3-yl]-2-oxopropyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 58463896 |
| Molecular Formula | C27H30F3IN2O3 |
| Molecular Weight | 614.45 g/mol |
| Exact Mass | 614.13 |
| IUPAC Name | N-[3-[(3S)-1-[4-hydroxy-4-(4-iodophenyl)cyclohexyl]pyrrolidin-3-yl]-2-oxopropyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)C[C@@H]1CCN(C2CCC(O)(c3ccc(I)cc3)CC2)C1 |
| InChI | InChI=1S/C27H30F3IN2O3/c28-27(29,30)21-3-1-2-19(15-21)25(35)32-16-24(34)14-18-10-13-33(17-18)23-8-11-26(36,12-9-23)20-4-6-22(31)7-5-20/h1-7,15,18,23,36H,8-14,16-17H2,(H,32,35)/t18-,23?,26?/m0/s1 |
| InChIKey | JRDUPLFRVACCIT-MSQOXCFKSA-N |
| XLogP | 5.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|