About 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one
4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one (PubChem CID 58464024) has the molecular formula C15H22N4OSi
and a molecular weight of 302.45 g/mol. Its IUPAC name is 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one |
| PubChem CID | 58464024 |
| Molecular Formula | C15H22N4OSi |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one |
| SMILES | CC1(C)CCN(c2ncc(C#C[Si](C)(C)C)cn2)C(=O)N1 |
| InChI | InChI=1S/C15H22N4OSi/c1-15(2)7-8-19(14(20)18-15)13-16-10-12(11-17-13)6-9-21(3,4)5/h10-11H,7-8H2,1-5H3,(H,18,20) |
| InChIKey | LLCIPAARRQFRNP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one?
The IUPAC name of 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one (CID 58464024) is 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one.
What is the SMILES notation for 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one?
The canonical SMILES for 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one is CC1(C)CCN(c2ncc(C#C[Si](C)(C)C)cn2)C(=O)N1.
What is the InChIKey of 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one?
The InChIKey is LLCIPAARRQFRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4OSi/c1-15(2)7-8-19(14(20)18-15)13-16-10-12(11-17-13)6-9-21(3,4)5/h10-11H,7-8H2,1-5H3,(H,18,20).
What are the key properties of 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one?
4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one has a molecular weight of 302.45 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-1-[5-(2-trimethylsilylethynyl)pyrimidin-2-yl]-1,3-diazinan-2-one is sourced from PubChem (CID 58464024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).