C12H13IN2O2 — CID 58464073
(4aS,7aS)-3-(5-iodo-2-pyridinyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazin-2-one (PubChem CID 58464073) has the molecular formula C12H13IN2O2 and a molecular weight of 344.15 g/mol. Its IUPAC name is (4aS,7aS)-3-(5-iodo-2-pyridinyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazin-2-one.
| Compound Name | (4aS,7aS)-3-(5-iodo-2-pyridinyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 58464073 |
| Molecular Formula | C12H13IN2O2 |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (4aS,7aS)-3-(5-iodo-2-pyridinyl)-4,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazin-2-one |
| SMILES | O=C1O[C@H]2CCC[C@H]2CN1c1ccc(I)cn1 |
| InChI | InChI=1S/C12H13IN2O2/c13-9-4-5-11(14-6-9)15-7-8-2-1-3-10(8)17-12(15)16/h4-6,8,10H,1-3,7H2/t8-,10-/m0/s1 |
| InChIKey | ORANROFCHKSTMA-WPRPVWTQSA-N |
| XLogP | 2.81 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|