About 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one
5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one (PubChem CID 58464075) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one |
| PubChem CID | 58464075 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one |
| SMILES | COC1CNC(=O)OC1(C)C |
| InChI | InChI=1S/C7H13NO3/c1-7(2)5(10-3)4-8-6(9)11-7/h5H,4H2,1-3H3,(H,8,9) |
| InChIKey | ANHHERBVYQLEGK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one?
The IUPAC name of 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one (CID 58464075) is 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one.
What is the SMILES notation for 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one?
The canonical SMILES for 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one is COC1CNC(=O)OC1(C)C.
What is the InChIKey of 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one?
The InChIKey is ANHHERBVYQLEGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-7(2)5(10-3)4-8-6(9)11-7/h5H,4H2,1-3H3,(H,8,9).
What are the key properties of 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one?
5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one has a molecular weight of 159.18 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6,6-dimethyl-1,3-oxazinan-2-one is sourced from PubChem (CID 58464075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).