About 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide
5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide (PubChem CID 58464761) has the molecular formula C14H21N7OS
and a molecular weight of 335.44 g/mol. Its IUPAC name is 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 58464761 |
| Molecular Formula | C14H21N7OS |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide |
| SMILES | Cn1ncc(NC(=O)c2ncsc2N)c1N1CCC(CN)CC1 |
| InChI | InChI=1S/C14H21N7OS/c1-20-14(21-4-2-9(6-15)3-5-21)10(7-18-20)19-13(22)11-12(16)23-8-17-11/h7-9H,2-6,15-16H2,1H3,(H,19,22) |
| InChIKey | ZWRSWEFKWSYBQO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide (CID 58464761) is 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide is Cn1ncc(NC(=O)c2ncsc2N)c1N1CCC(CN)CC1.
What is the InChIKey of 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide?
The InChIKey is ZWRSWEFKWSYBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N7OS/c1-20-14(21-4-2-9(6-15)3-5-21)10(7-18-20)19-13(22)11-12(16)23-8-17-11/h7-9H,2-6,15-16H2,1H3,(H,19,22).
What are the key properties of 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide?
5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide has a molecular weight of 335.44 g/mol, XLogP of 0.89, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-N-[5-[4-(aminomethyl)piperidin-1-yl]-1-methylpyrazol-4-yl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 58464761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).